EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H20O4S |
| Net Charge | 0 |
| Average Mass | 224.322 |
| Monoisotopic Mass | 224.10823 |
| SMILES | CC(C)CCC[C@H](C)COS(=O)(=O)O |
| InChI | InChI=1S/C9H20O4S/c1-8(2)5-4-6-9(3)7-13-14(10,11)12/h8-9H,4-7H2,1-3H3,(H,10,11,12)/t9-/m0/s1 |
| InChIKey | LICTUMJMBMBMQH-VIFPVBQESA-N |
| Roles Classification |
|---|
| Biological Roles: | Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2,6-dimethylheptyl hydrogen sulfate (CHEBI:83109) is a 2,6-dimethylheptyl hydrogen sulfate (CHEBI:83108) |
| (2S)-2,6-dimethylheptyl hydrogen sulfate (CHEBI:83109) is conjugate acid of (2S)-2,6-dimethylheptyl sulfate (CHEBI:83011) |
| (2S)-2,6-dimethylheptyl hydrogen sulfate (CHEBI:83109) is enantiomer of (2R)-2,6-dimethylheptyl hydrogen sulfate (CHEBI:83110) |
| Incoming Relation(s) |
| (2S)-2,6-dimethylheptyl sulfate (CHEBI:83011) is conjugate base of (2S)-2,6-dimethylheptyl hydrogen sulfate (CHEBI:83109) |
| (2R)-2,6-dimethylheptyl hydrogen sulfate (CHEBI:83110) is enantiomer of (2S)-2,6-dimethylheptyl hydrogen sulfate (CHEBI:83109) |
| IUPAC Name |
|---|
| (2S)-2,6-dimethylheptyl hydrogen sulfate |