EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H95N16O13R.(H2O4S)x |
| SMILES | *CC(C)CCCCC(=O)N[C@@H](CCN)C(=O)N[C@H](C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](Cc2ccccc2)NC(=O)[C@H](CCN)NC1=O)[C@@H](C)O.O=S(=O)(O)O |
| Roles Classification |
|---|
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Polymyxin B sulfate (CHEBI:8310) has role anti-inflammatory agent (CHEBI:67079) |
| Polymyxin B sulfate (CHEBI:8310) has role antiinfective agent (CHEBI:35441) |
| Polymyxin B sulfate (CHEBI:8310) has role dermatologic drug (CHEBI:50177) |
| Polymyxin B sulfate (CHEBI:8310) is a polymer (CHEBI:60027) |
| Synonyms | Source |
|---|---|
| NSC-757278 | ChEMBL |
| Polymixin B sulfate | KEGG COMPOUND |
| Polymixin b sulphate | ChEMBL |
| Polymyxin b, sulfate | ChEMBL |
| Polymyxin B sulfate | KEGG COMPOUND |
| Polymyxin b sulphate | ChEMBL |
| Brand Names | Source |
|---|---|
| Aerosporin | ChEMBL |
| Gppe pdr ster | ChEMBL |
| Polyfax | ChEMBL |
| Polymycin b sulfate | ChEMBL |
| Polymyxin b sulfate component of chloromyxin | ChEMBL |
| Polymyxin b sulfate component of cortisporin | ChEMBL |
| Citations |
|---|