EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25N5O8PS2 |
| Net Charge | -1 |
| Average Mass | 534.533 |
| Monoisotopic Mass | 534.08876 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])OC(=O)CCCC[C@@H]2CCSS2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H26N5O8PS2/c19-16-13-17(21-8-20-16)23(9-22-13)18-15(26)14(25)11(30-18)7-29-32(27,28)31-12(24)4-2-1-3-10-5-6-33-34-10/h8-11,14-15,18,25-26H,1-7H2,(H,27,28)(H2,19,20,21)/p-1/t10-,11-,14-,15-,18-/m1/s1 |
| InChIKey | QWEGOCJRZOKSOE-ADUAKINBSA-M |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-lipoyl-AMP(1−) (CHEBI:83091) is a lipoyl-AMP(1−) (CHEBI:58923) |
| (R)-lipoyl-AMP(1−) (CHEBI:83091) is conjugate base of (R)-lipoyl-AMP (CHEBI:83864) |
| Incoming Relation(s) |
| (R)-lipoyl-AMP (CHEBI:83864) is conjugate acid of (R)-lipoyl-AMP(1−) (CHEBI:83091) |
| IUPAC Name |
|---|
| 5'-O-[({5-[(3R)-1,2-dithiolan-3-yl]pentanoyl}oxy)phosphinato]adenosine |
| UniProt Name | Source |
|---|---|
| (R)-lipoyl-5'-AMP | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LIPOYL-AMP | MetaCyc |