EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O4S |
| Net Charge | 0 |
| Average Mass | 234.317 |
| Monoisotopic Mass | 234.09258 |
| SMILES | CC/C=C\C/C=C\CCCOS(=O)(=O)O |
| InChI | InChI=1S/C10H18O4S/c1-2-3-4-5-6-7-8-9-10-14-15(11,12)13/h3-4,6-7H,2,5,8-10H2,1H3,(H,11,12,13)/b4-3-,7-6- |
| InChIKey | IUFFPMSLKYCSDC-CWWKMNTPSA-N |
| Roles Classification |
|---|
| Biological Roles: | kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4Z,7Z)-deca-4,7-dien-1-yl hydrogen sulfate (CHEBI:83082) has role Daphnia pulex metabolite (CHEBI:83075) |
| (4Z,7Z)-deca-4,7-dien-1-yl hydrogen sulfate (CHEBI:83082) has role kairomone (CHEBI:83074) |
| (4Z,7Z)-deca-4,7-dien-1-yl hydrogen sulfate (CHEBI:83082) is a organic sulfate (CHEBI:25704) |
| (4Z,7Z)-deca-4,7-dien-1-yl hydrogen sulfate (CHEBI:83082) is a sulfuric ester (CHEBI:26819) |
| (4Z,7Z)-deca-4,7-dien-1-yl hydrogen sulfate (CHEBI:83082) is conjugate acid of (4Z,7Z)-deca-4,7-dien-1-yl sulfate (CHEBI:82994) |
| Incoming Relation(s) |
| (4Z,7Z)-deca-4,7-dien-1-yl sulfate (CHEBI:82994) is conjugate base of (4Z,7Z)-deca-4,7-dien-1-yl hydrogen sulfate (CHEBI:83082) |
| IUPAC Name |
|---|
| (4Z,7Z)-deca-4,7-dien-1-yl hydrogen sulfate |