EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H22O4S |
| Net Charge | 0 |
| Average Mass | 250.360 |
| Monoisotopic Mass | 250.12388 |
| SMILES | CC(C)CCCC/C=C\CCOS(=O)(=O)O |
| InChI | InChI=1S/C11H22O4S/c1-11(2)9-7-5-3-4-6-8-10-15-16(12,13)14/h4,6,11H,3,5,7-10H2,1-2H3,(H,12,13,14)/b6-4- |
| InChIKey | KFSZKAMIIWDKKZ-XQRVVYSFSA-N |
| Roles Classification |
|---|
| Biological Roles: | Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3Z)-9-methyldec-3-en-1-yl hydrogen sulfate (CHEBI:83078) has role Daphnia pulex metabolite (CHEBI:83075) |
| (3Z)-9-methyldec-3-en-1-yl hydrogen sulfate (CHEBI:83078) has role kairomone (CHEBI:83074) |
| (3Z)-9-methyldec-3-en-1-yl hydrogen sulfate (CHEBI:83078) is a organic sulfate (CHEBI:25704) |
| (3Z)-9-methyldec-3-en-1-yl hydrogen sulfate (CHEBI:83078) is a sulfuric ester (CHEBI:26819) |
| (3Z)-9-methyldec-3-en-1-yl hydrogen sulfate (CHEBI:83078) is conjugate acid of (3Z)-9-methyldec-3-en-1-yl sulfate (CHEBI:82993) |
| Incoming Relation(s) |
| (3Z)-9-methyldec-3-en-1-yl sulfate (CHEBI:82993) is conjugate base of (3Z)-9-methyldec-3-en-1-yl hydrogen sulfate (CHEBI:83078) |
| IUPAC Name |
|---|
| (3Z)-9-methyldec-3-en-1-yl hydrogen sulfate |