EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25NO3S |
| Net Charge | 0 |
| Average Mass | 359.491 |
| Monoisotopic Mass | 359.15551 |
| SMILES | Cc1cc(OC(C)C)ccc1C(=O)C(C)(C)NC(=O)c1sccc1C |
| InChI | InChI=1S/C20H25NO3S/c1-12(2)24-15-7-8-16(14(4)11-15)18(22)20(5,6)21-19(23)17-13(3)9-10-25-17/h7-12H,1-6H3,(H,21,23) |
| InChIKey | WMKZDPFZIZQROT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor An EC 1.3.5.* (oxidoreductase acting on CH-CH of donor with a quinone or related compound as acceptor) inhibitor that interferes with the action of succinate dehydrogenase (quinone), EC 1.3.5.1. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isofetamid (CHEBI:83065) has role antifungal agrochemical (CHEBI:86328) |
| isofetamid (CHEBI:83065) has role EC 1.3.5.1 [succinate dehydrogenase (quinone)] inhibitor (CHEBI:83072) |
| isofetamid (CHEBI:83065) is a amide fungicide (CHEBI:60600) |
| isofetamid (CHEBI:83065) is a aromatic amide (CHEBI:62733) |
| isofetamid (CHEBI:83065) is a aromatic ether (CHEBI:35618) |
| isofetamid (CHEBI:83065) is a aromatic ketone (CHEBI:76224) |
| isofetamid (CHEBI:83065) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| N-[1-(4-isopropoxy-2-methylphenyl)-2-methyl-1-oxopropan-2-yl]-3-methylthiophene-2-carboxamide |
| Synonyms | Source |
|---|---|
| 3-methyl-N-{2-methyl-1-[2-methyl-4-(propan-2-yloxy)phenyl]-1-oxopropan-2-yl}thiophene-2-carboxamide | Alan Wood's Pesticides |
| N-[1,1-dimethyl-2-[2-methyl-4-(1-methylethoxy)phenyl]-2-oxoethyl]-3-methyl-2-thiophenecarboxamide | Alan Wood's Pesticides |
| N-[1,1-dimethyl-2-(4-isopropoxy-o-tolyl)-2-oxoethyl]-3-methylthiophene-2-carboxamide | Alan Wood's Pesticides |
| IKF 5411 | ChemIDplus |
| IKF-5411 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2781 | PPDB |
| isofetamid | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11931431 | Reaxys |
| CAS:875915-78-9 | ChemIDplus |