EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H44NO7P |
| Net Charge | 0 |
| Average Mass | 477.579 |
| Monoisotopic Mass | 477.28554 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OCCN |
| InChI | InChI=1S/C23H44NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(26)29-20-22(25)21-31-32(27,28)30-19-18-24/h6-7,9-10,22,25H,2-5,8,11-21,24H2,1H3,(H,27,28)/b7-6-,10-9-/t22-/m1/s1 |
| InChIKey | DBHKHNGBVGWQJE-USWSLJGRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| - | PubMed (21886157) | ||
| - | MetaboLights (MTBLS354) | ||
| Mus musculus (ncbitaxon:10090) | |||
| - | MetaboLights (MTBLS334) | ||
| small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse | |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | whole organism (UBERON:0000468) | MetaboLights (MTBLS3486) | |
| Ovis aries (ncbitaxon:9940) | - | MetaboLights (MTBLS322) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-linoleoyl-sn-glycero-3-phosphoethanolamine (CHEBI:83058) has functional parent linoleic acid (CHEBI:17351) |
| 1-linoleoyl-sn-glycero-3-phosphoethanolamine (CHEBI:83058) has role human metabolite (CHEBI:77746) |
| 1-linoleoyl-sn-glycero-3-phosphoethanolamine (CHEBI:83058) is a lysophosphatidylethanolamine (18:2/0:0) (CHEBI:131744) |
| 1-linoleoyl-sn-glycero-3-phosphoethanolamine (CHEBI:83058) is tautomer of 1-linoleoyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:133732) |
| Incoming Relation(s) |
| 1-linoleoyl-sn-glycero-3-phosphoethanolamine zwitterion (CHEBI:133732) is tautomer of 1-linoleoyl-sn-glycero-3-phosphoethanolamine (CHEBI:83058) |
| IUPAC Name |
|---|
| (2R)-3-{[(2-aminoethoxy)(hydroxy)phosphoryl]oxy}-2-hydroxypropyl (9Z,12Z)-octadeca-9,12-dienoate |
| Synonyms | Source |
|---|---|
| 1-(9Z,12Z-octadecadienoyl)-2-hydroxy-sn-glycero-3-phosphoethanolamine | ChEBI |
| 1-(9Z,12Z-octadecadienoyl)-glycero-3-phosphoethanolamine | LIPID MAPS |
| 1-Linoleoyl-2-hydroxy-sn-glycero-3-phosphoethanolamine | HMDB |
| 1-linoleoyl-GPE | ChEBI |
| 1-linoleoyl-GPE (18:2) | ChEBI |
| (2R)-3-[[(2-aminoethoxy)hydroxyphosphinyl]oxy]-2-hydroxypropyl (9Z,12Z)-9,12-octadecadienoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011507 | HMDB |
| LMGP02050011 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:85046-18-0 | ChEBI |
| Citations |
|---|