EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36O4 |
| Net Charge | 0 |
| Average Mass | 460.614 |
| Monoisotopic Mass | 460.26136 |
| SMILES | CC(/C=C/C=C(C)/C=C/C=C(\C)C(=O)O)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C=C(/C)C(=O)O |
| InChI | InChI=1S/C30H36O4/c1-23(15-9-17-25(3)19-11-21-27(5)29(31)32)13-7-8-14-24(2)16-10-18-26(4)20-12-22-28(6)30(33)34/h7-22H,1-6H3,(H,31,32)(H,33,34)/b8-7+,15-9+,16-10+,19-11+,20-12+,23-13+,24-14+,25-17+,26-18+,27-21+,28-22+ |
| InChIKey | YMOJEHLMENKTSQ-GVCQAPIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Methylobacterium rhodinum (ncbitaxon:29428) | - | PubMed (15933032) | Strain: ATCC 14821 |
| Methylomonas sp. 16a (ncbitaxon:318114) | - | PubMed (15933032) | Strain: ATCC PTA-2402 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,4'-diapolycopenedioic acid (CHEBI:83043) has parent hydride 4,4'-diapolycopene (CHEBI:62449) |
| 4,4'-diapolycopenedioic acid (CHEBI:83043) has role bacterial metabolite (CHEBI:76969) |
| 4,4'-diapolycopenedioic acid (CHEBI:83043) is a apo carotenoid triterpenoid (CHEBI:36783) |
| 4,4'-diapolycopenedioic acid (CHEBI:83043) is a olefinic compound (CHEBI:78840) |
| 4,4'-diapolycopenedioic acid (CHEBI:83043) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| 4,4'-diapolycopenedioic acid (CHEBI:83043) is conjugate acid of 4,4'-diapolycopenedioate (CHEBI:79063) |
| Incoming Relation(s) |
| 4,4'-diapolycopenedioate (CHEBI:79063) is conjugate base of 4,4'-diapolycopenedioic acid (CHEBI:83043) |
| IUPAC Name |
|---|
| (2E,4E,6E,8E,10E,12E,14E,16E,18E,20E,22E)-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,20,22-undecaenedioic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-13151 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22781659 | Reaxys |
| Citations |
|---|