EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O8 |
| Net Charge | 0 |
| Average Mass | 326.301 |
| Monoisotopic Mass | 326.10017 |
| SMILES | O=C(O)/C=C/c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C15H18O8/c16-7-10-12(19)13(20)14(21)15(23-10)22-9-4-1-8(2-5-9)3-6-11(17)18/h1-6,10,12-16,19-21H,7H2,(H,17,18)/b6-3+/t10-,12-,13+,14-,15-/m1/s1 |
| InChIKey | LJFYQZQUAULRDF-FDGSXQGBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-β-D-glucosyl-trans-4-coumaric acid (CHEBI:83032) has role plant metabolite (CHEBI:76924) |
| 4-O-β-D-glucosyl-trans-4-coumaric acid (CHEBI:83032) is a 4-O-β-D-glucosyl-4-coumaric acid (CHEBI:17335) |
| 4-O-β-D-glucosyl-trans-4-coumaric acid (CHEBI:83032) is conjugate acid of 4-O-β-D-glucosyl-trans-4-coumarate (CHEBI:79066) |
| Incoming Relation(s) |
| 4-O-β-D-glucosyl-trans-4-coumarate (CHEBI:79066) is conjugate base of 4-O-β-D-glucosyl-trans-4-coumaric acid (CHEBI:83032) |
| IUPAC Name |
|---|
| (2E)-3-[4-(β-D-glucopyranosyloxy)phenyl]prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| (2E)-3-[4-(β-D-glucopyranosyloxy)phenyl]acrylic acid | IUPAC |
| 3-(4-(beta-D-Glucopyranosyloxy)phenyl)-2-Propenoic acid | HMDB |
| 4-O-β-D-glucosyl-4-hydroxycinnamic acid | ChEBI |
| 4-O-[4-(2-Carboxyvinyl)phenyl]-beta-D-glucopyranose | HMDB |
| 4-O-beta-D-Glucosyl-4-coumaric acid | HMDB |
| trans-β-D-glucosyl-4-hydroxycinnamic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-457 | MetaCyc |
| HMDB0039509 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3563646 | Reaxys |
| CAS:14364-05-7 | HMDB |