EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O2 |
| Net Charge | 0 |
| Average Mass | 248.366 |
| Monoisotopic Mass | 248.17763 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O |
| InChI | InChI=1S/C16H24O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h3-4,6-7,9-10,12-13H,2,5,8,11,14-15H2,1H3,(H,17,18)/b4-3-,7-6-,10-9-,13-12- |
| InChIKey | IVTCJQZAGWTMBZ-LTKCOYKYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia galeata (ncbitaxon:27404) | - | Article (Is the fatty acid composition of Daphnia galeata determined by the fatty acid composition of the ingested diet?Weers P.M.M., Siewertsen K., and Gulati R.D.Freshwater Biology (1997), 38, 731-738) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Daphnia galeata metabolite A Daphnia metabolite produced by the species Daphnia galeata. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoic acid (CHEBI:83030) has role Daphnia galeata metabolite (CHEBI:83038) |
| (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoic acid (CHEBI:83030) is a long-chain fatty acid (CHEBI:15904) |
| (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoic acid (CHEBI:83030) is a polyunsaturated fatty acid (CHEBI:26208) |
| (4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoic acid (CHEBI:83030) is a straight-chain fatty acid (CHEBI:59202) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1961728 | Reaxys |