EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@H]1O[C@@H](O)[C@@H](O)[C@@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a1112h-1b_1-5]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4+,5+,6-/m1/s1 |
| InChIKey | WQZGKKKJIJFFOK-QBFJYBIGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) |
| Roles Classification |
|---|
| Biological Role: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-talopyranose (CHEBI:83029) is a D-talopyranose (CHEBI:68462) |
| β-D-talopyranose (CHEBI:83029) is enantiomer of β-L-talopyranose (CHEBI:155465) |
| Incoming Relation(s) |
| β-L-talopyranose (CHEBI:155465) is enantiomer of β-D-talopyranose (CHEBI:83029) |
| Synonym | Source |
|---|---|
| β-D-talose | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| G35338PW | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1723629 | Reaxys |