EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19O4S |
| Net Charge | -1 |
| Average Mass | 223.314 |
| Monoisotopic Mass | 223.10095 |
| SMILES | CC[C@H](C)CCCCCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H20O4S/c1-3-9(2)7-5-4-6-8-13-14(10,11)12/h9H,3-8H2,1-2H3,(H,10,11,12)/p-1/t9-/m0/s1 |
| InChIKey | GAKXDBIEPWUONH-VIFPVBQESA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia pulex (ncbitaxon:6669) | - | Article (Isolation and Absolute Configuration Determination of Aliphatic Sulfates as the Daphnia Kairomones Inducing Morphological Defense of a Phytoplankton Ko YASUMOTO, Akinori NISHIGAMI, Fumie KASAI, Takenori KUSUMI, and Takashi OOI Chem. Pharm. Bull. 54(2) 271-274 (2006)) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6S)-6-methyloctyl sulfate (CHEBI:83013) is a sulfuric ester (CHEBI:26819) |