EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19O4S |
| Net Charge | -1 |
| Average Mass | 223.314 |
| Monoisotopic Mass | 223.10095 |
| SMILES | CC(C)CCC[C@@H](C)COS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H20O4S/c1-8(2)5-4-6-9(3)7-13-14(10,11)12/h8-9H,4-7H2,1-3H3,(H,10,11,12)/p-1/t9-/m1/s1 |
| InChIKey | LICTUMJMBMBMQH-SECBINFHSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia pulex (ncbitaxon:6669) | - | Article (Isolation and Absolute Configuration Determination of Aliphatic Sulfates as the Daphnia Kairomones Inducing Morphological Defense of a PhytoplanktonKo YASUMOTO, Akinori NISHIGAMI, Fumie KASAI, Takenori KUSUMI, and Takashi OOIChem. Pharm. Bull. 54(2) 271-274 (2006)) |
| Roles Classification |
|---|
| Biological Roles: | kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-2,6-dimethylheptyl sulfate (CHEBI:83012) is a 2,6-dimethylheptyl sulfate (CHEBI:83107) |
| (2R)-2,6-dimethylheptyl sulfate (CHEBI:83012) is conjugate base of (2R)-2,6-dimethylheptyl hydrogen sulfate (CHEBI:83110) |
| (2R)-2,6-dimethylheptyl sulfate (CHEBI:83012) is enantiomer of (2S)-2,6-dimethylheptyl sulfate (CHEBI:83011) |
| Incoming Relation(s) |
| (2R)-2,6-dimethylheptyl hydrogen sulfate (CHEBI:83110) is conjugate acid of (2R)-2,6-dimethylheptyl sulfate (CHEBI:83012) |
| (2S)-2,6-dimethylheptyl sulfate (CHEBI:83011) is enantiomer of (2R)-2,6-dimethylheptyl sulfate (CHEBI:83012) |
| IUPAC Name |
|---|
| (2R)-2,6-dimethylheptyl sulfate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8691836 | Reaxys |
| Citations |
|---|