EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H20O |
| Net Charge | 0 |
| Average Mass | 144.258 |
| Monoisotopic Mass | 144.15142 |
| SMILES | CC(C)CCC[C@@H](C)CO |
| InChI | InChI=1S/C9H20O/c1-8(2)5-4-6-9(3)7-10/h8-10H,4-7H2,1-3H3/t9-/m1/s1 |
| InChIKey | RCYIBFNZRWQGNB-SECBINFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia pulex (ncbitaxon:6669) | - | Article (Isolation and Absolute Configuration Determination of Aliphatic Sulfates as the Daphnia Kairomones Inducing Morphological Defense of a PhytoplanktonKo YASUMOTO, Akinori NISHIGAMI, Fumie KASAI, Takenori KUSUMI, and Takashi OOIChem. Pharm. Bull. 54(2) 271-274 (2006)) | Isolated as the sulfate conjugate. |
| Roles Classification |
|---|
| Biological Role: | Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-2,6-dimethylheptan-1-ol (CHEBI:83009) is a 2,6-dimethylheptan-1-ol (CHEBI:83104) |
| (2R)-2,6-dimethylheptan-1-ol (CHEBI:83009) is enantiomer of (2S)-2,6-dimethylheptan-1-ol (CHEBI:83008) |
| Incoming Relation(s) |
| (2S)-2,6-dimethylheptan-1-ol (CHEBI:83008) is enantiomer of (2R)-2,6-dimethylheptan-1-ol (CHEBI:83009) |
| IUPAC Name |
|---|
| (2R)-2,6-dimethylheptan-1-ol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4361052 | Reaxys |
| Citations |
|---|