EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22NO3S |
| Net Charge | -1 |
| Average Mass | 260.379 |
| Monoisotopic Mass | 260.13259 |
| SMILES | CCCCC/C=C\C/C=C\CCNS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H23NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-17(14,15)16/h6-7,9-10,13H,2-5,8,11-12H2,1H3,(H,14,15,16)/p-1/b7-6-,10-9- |
| InChIKey | DLEYFILNNFMARG-HZJYTTRNSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia pulex (ncbitaxon:6669) | - | Article (Isolation of New Aliphatic Sulfates and Sulfamate as the Daphnia Kairomones Inducing Morphological Change of a Phytoplankton Scenedesmus gutwinskii Ko YASUMOTO, Akinori NISHIGAMI, Hiroaki AOI, Chise TSUCHIHASHI, Fumie KASAI,Takenori KUSUMI, and Takashi OOI Chem. Pharm. Bull. 56(1) 133-136 (2008)) |
| Roles Classification |
|---|
| Biological Roles: | Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3Z,6Z)-dodeca-3,6-dien-1-ylsulfamate (CHEBI:82997) has role Daphnia pulex metabolite (CHEBI:83075) |
| (3Z,6Z)-dodeca-3,6-dien-1-ylsulfamate (CHEBI:82997) has role kairomone (CHEBI:83074) |
| (3Z,6Z)-dodeca-3,6-dien-1-ylsulfamate (CHEBI:82997) is a organic sulfamate oxoanion (CHEBI:61660) |
| (3Z,6Z)-dodeca-3,6-dien-1-ylsulfamate (CHEBI:82997) is conjugate base of (3Z,6Z)-dodeca-3,6-dien-1-ylsulfamic acid (CHEBI:83085) |
| Incoming Relation(s) |
| (3Z,6Z)-dodeca-3,6-dien-1-ylsulfamic acid (CHEBI:83085) is conjugate acid of (3Z,6Z)-dodeca-3,6-dien-1-ylsulfamate (CHEBI:82997) |
| IUPAC Name |
|---|
| (3Z,6Z)-dodeca-3,6-dien-1-ylsulfamate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15864355 | Reaxys |
| Citations |
|---|