EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:82996 - (3Z)-dec-3-en-1-ylsulfamate
| Formula | C10H20NO3S |
| Net Charge | -1 |
| Average Mass | 234.341 |
| Monoisotopic Mass | 234.11694 |
| SMILES | CCCCCC/C=C\CCNS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H21NO3S/c1-2-3-4-5-6-7-8-9-10-11-15(12,13)14/h7-8,11H,2-6,9-10H2,1H3,(H,12,13,14)/p-1/b8-7- |
| InChIKey | WBTJXIONXAFNAJ-FPLPWBNLSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia pulex (ncbitaxon:6669) | - | Article (Isolation of New Aliphatic Sulfates and Sulfamate as the Daphnia Kairomones Inducing Morphological Change of a Phytoplankton Scenedesmus gutwinskii Ko YASUMOTO, Akinori NISHIGAMI, Hiroaki AOI, Chise TSUCHIHASHI, Fumie KASAI,Takenori KUSUMI, and Takashi OOI Chem. Pharm. Bull. 56(1) 133-136 (2008)) |
| Roles Classification |
|---|
| Biological Roles: | Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3Z)-dec-3-en-1-ylsulfamate (CHEBI:82996) has role Daphnia pulex metabolite (CHEBI:83075) |
| (3Z)-dec-3-en-1-ylsulfamate (CHEBI:82996) has role kairomone (CHEBI:83074) |
| (3Z)-dec-3-en-1-ylsulfamate (CHEBI:82996) is a organic sulfamate oxoanion (CHEBI:61660) |
| (3Z)-dec-3-en-1-ylsulfamate (CHEBI:82996) is conjugate base of (3Z)-dec-3-en-1-ylsulfamic acid (CHEBI:83084) |
| Incoming Relation(s) |
| (3Z)-dec-3-en-1-ylsulfamic acid (CHEBI:83084) is conjugate acid of (3Z)-dec-3-en-1-ylsulfamate (CHEBI:82996) |
| IUPAC Name |
|---|
| (3Z)-dec-3-en-1-ylsulfamate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15864351 | Reaxys |
| Citations |
|---|