EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19O4S |
| Net Charge | -1 |
| Average Mass | 223.314 |
| Monoisotopic Mass | 223.10095 |
| SMILES | CC(C)CCCCCCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H20O4S/c1-9(2)7-5-3-4-6-8-13-14(10,11)12/h9H,3-8H2,1-2H3,(H,10,11,12)/p-1 |
| InChIKey | ARACXKCAGMFROY-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia pulex (ncbitaxon:6669) | - | Article (Isolation of New Aliphatic Sulfates and Sulfamate as the Daphnia Kairomones Inducing Morphological Change of a Phytoplankton Scenedesmus gutwinskii Ko YASUMOTO, Akinori NISHIGAMI, Hiroaki AOI, Chise TSUCHIHASHI, Fumie KASAI,Takenori KUSUMI, and Takashi OOI Chem. Pharm. Bull. 56(1) 133- 136 (2008)) |
| Roles Classification |
|---|
| Biological Roles: | Daphnia pulex metabolite A Daphnia metabolite produced by the species Daphnia pulex. kairomone A semiochemical used for inter-species chemical communication in a way that benefits an individual of another species that receives the chemical signal. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-methyloctyl sulfate (CHEBI:82991) has role Daphnia pulex metabolite (CHEBI:83075) |
| 7-methyloctyl sulfate (CHEBI:82991) has role kairomone (CHEBI:83074) |
| 7-methyloctyl sulfate (CHEBI:82991) is a organosulfate oxoanion (CHEBI:58958) |
| 7-methyloctyl sulfate (CHEBI:82991) is conjugate base of 7-methyloctyl hydrogen sulfate (CHEBI:83073) |
| Incoming Relation(s) |
| 7-methyloctyl hydrogen sulfate (CHEBI:83073) is conjugate acid of 7-methyloctyl sulfate (CHEBI:82991) |
| IUPAC Name |
|---|
| 7-methyloctyl sulfate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15864345 | Reaxys |
| Citations |
|---|