EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O4 |
| Net Charge | 0 |
| Average Mass | 324.461 |
| Monoisotopic Mass | 324.23006 |
| SMILES | [H][C@@]12C=C[C@H](C)[C@H](CC[C@@H](O)C[C@@H](O)CC(=O)O)[C@@]1([H])CC[C@@H](C)C2 |
| InChI | InChI=1S/C19H32O4/c1-12-3-7-18-14(9-12)5-4-13(2)17(18)8-6-15(20)10-16(21)11-19(22)23/h4-5,12-18,20-21H,3,6-11H2,1-2H3,(H,22,23)/t12-,13+,14+,15-,16-,17+,18+/m1/s1 |
| InChIKey | NYKUCCPVLWRDEZ-VCWNUMGPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydromonacolin L acid (CHEBI:82970) has functional parent dihydromonacolin L (CHEBI:14158) |
| dihydromonacolin L acid (CHEBI:82970) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| dihydromonacolin L acid (CHEBI:82970) is a carbobicyclic compound (CHEBI:36785) |
| dihydromonacolin L acid (CHEBI:82970) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| dihydromonacolin L acid (CHEBI:82970) is a octahydronaphthalenes (CHEBI:138397) |
| dihydromonacolin L acid (CHEBI:82970) is a polyketide (CHEBI:26188) |
| dihydromonacolin L acid (CHEBI:82970) is conjugate acid of dihydromonacolin L carboxylate (CHEBI:79031) |
| Incoming Relation(s) |
| 3α-hydroxy-3,5-dihydromonacolin L acid (CHEBI:82972) has functional parent dihydromonacolin L acid (CHEBI:82970) |
| dihydromonacolin L carboxylate (CHEBI:79031) is conjugate base of dihydromonacolin L acid (CHEBI:82970) |
| IUPAC Name |
|---|
| (3R,5R)-7-[(1S,2S,4aR,6R,8aS)-2,6-dimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3,5-dihydroxyheptanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23775017 | Reaxys |
| Citations |
|---|