EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31O8 |
| Net Charge | -1 |
| Average Mass | 447.504 |
| Monoisotopic Mass | 447.20244 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](O[C@@H]3O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]3O)CC[C@@]21[H] |
| InChI | InChI=1S/C24H32O8/c1-24-9-8-14-13-5-3-12(25)10-11(13)2-4-15(14)16(24)6-7-17(24)31-23-20(28)18(26)19(27)21(32-23)22(29)30/h3,5,10,14-21,23,25-28H,2,4,6-9H2,1H3,(H,29,30)/p-1/t14-,15-,16+,17+,18+,19+,20-,21+,23-,24+/m1/s1 |
| InChIKey | MTKNDAQYHASLID-QXYWQCSFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17β-estradiol 17-glucosiduronate (CHEBI:82961) is a estrane conjugate (CHEBI:167107) |
| 17β-estradiol 17-glucosiduronate (CHEBI:82961) is a monocarboxylic acid anion (CHEBI:35757) |
| 17β-estradiol 17-glucosiduronate (CHEBI:82961) is a steroid glucosiduronic acid anion (CHEBI:136637) |
| 17β-estradiol 17-glucosiduronate (CHEBI:82961) is a β-D-glucosiduronate (CHEBI:83411) |
| 17β-estradiol 17-glucosiduronate (CHEBI:82961) is conjugate base of 17β-estradiol 17-glucosiduronic acid (CHEBI:791) |
| Incoming Relation(s) |
| sodium 17β-estradiol 17-glucosiduronate (CHEBI:82962) has part 17β-estradiol 17-glucosiduronate (CHEBI:82961) |
| 17β-estradiol 17-glucosiduronic acid (CHEBI:791) is conjugate acid of 17β-estradiol 17-glucosiduronate (CHEBI:82961) |
| IUPAC Name |
|---|
| (17β)-3-hydroxyestra-1,3,5(10)-trien-17-yl β-D-glucopyranosiduronate |
| Synonym | Source |
|---|---|
| 17β-estradiol 17-glucuronate | ChEBI |
| UniProt Name | Source |
|---|---|
| 17β-estradiol 17-O-(β-D-glucuronate) | UniProt |