EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO6S |
| Net Charge | 0 |
| Average Mass | 261.255 |
| Monoisotopic Mass | 261.03071 |
| SMILES | COc1cc(OS(=O)(=O)O)ccc1NC(C)=O |
| InChI | InChI=1S/C9H11NO6S/c1-6(11)10-8-4-3-7(5-9(8)15-2)16-17(12,13)14/h3-5H,1-2H3,(H,10,11)(H,12,13,14) |
| InChIKey | NZKKXAGORRATJB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxyacetaminophen sulfate (CHEBI:82944) has functional parent paracetamol sulfate (CHEBI:32635) |
| 2-methoxyacetaminophen sulfate (CHEBI:82944) has role drug metabolite (CHEBI:49103) |
| 2-methoxyacetaminophen sulfate (CHEBI:82944) is a acetamides (CHEBI:22160) |
| 2-methoxyacetaminophen sulfate (CHEBI:82944) is a aryl sulfate (CHEBI:37919) |
| 2-methoxyacetaminophen sulfate (CHEBI:82944) is a monomethoxybenzene (CHEBI:25235) |
| 2-methoxyacetaminophen sulfate (CHEBI:82944) is conjugate acid of 2-methoxyacetaminophen sulfate(1−) (CHEBI:133502) |
| Incoming Relation(s) |
| 2-methoxyacetaminophen sulfate(1−) (CHEBI:133502) is conjugate base of 2-methoxyacetaminophen sulfate (CHEBI:82944) |
| IUPAC Name |
|---|
| 4-acetamido-3-methoxyphenyl hydrogen sulfate |
| Synonym | Source |
|---|---|
| 4-(acetylamino)-3-methoxyphenyl hydrogen sulfate | ChEBI |
| Citations |
|---|