EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO6S |
| Net Charge | 0 |
| Average Mass | 247.228 |
| Monoisotopic Mass | 247.01506 |
| SMILES | CC(=O)Nc1ccc(OS(=O)(=O)O)cc1O |
| InChI | InChI=1S/C8H9NO6S/c1-5(10)9-7-3-2-6(4-8(7)11)15-16(12,13)14/h2-4,11H,1H3,(H,9,10)(H,12,13,14) |
| InChIKey | HRLQZTOIKWEZBN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(acetylamino)-3-hydroxyphenyl hydrogen sulfate (CHEBI:82942) has functional parent paracetamol sulfate (CHEBI:32635) |
| 4-(acetylamino)-3-hydroxyphenyl hydrogen sulfate (CHEBI:82942) has role drug metabolite (CHEBI:49103) |
| 4-(acetylamino)-3-hydroxyphenyl hydrogen sulfate (CHEBI:82942) is a acetamides (CHEBI:22160) |
| 4-(acetylamino)-3-hydroxyphenyl hydrogen sulfate (CHEBI:82942) is a aryl sulfate (CHEBI:37919) |
| 4-(acetylamino)-3-hydroxyphenyl hydrogen sulfate (CHEBI:82942) is a phenols (CHEBI:33853) |
| 4-(acetylamino)-3-hydroxyphenyl hydrogen sulfate (CHEBI:82942) is conjugate acid of 4-(acetylamino)-3-hydroxyphenyl sulfate (CHEBI:133687) |
| Incoming Relation(s) |
| 4-(acetylamino)-3-hydroxyphenyl sulfate (CHEBI:133687) is conjugate base of 4-(acetylamino)-3-hydroxyphenyl hydrogen sulfate (CHEBI:82942) |
| IUPAC Name |
|---|
| 4-acetamido-3-hydroxyphenyl hydrogen sulfate |
| Synonym | Source |
|---|---|
| 2-hydroxyacetaminophen sulfate | ChEBI |
| Citations |
|---|