EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H46NO8R |
| Net Charge | 0 |
| Average Mass (excl. R groups) | 500.646 |
| Monoisotopic Mass (excl. R groups) | 500.32234 |
| SMILES | *C(=O)N[C@@H](CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)/C=C/CC/C=C(\C)CCCCCCCCC |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-D-glucosyl-(1↔1')-N-acyl-(4E,8E)-9-methylsphinga-4,8-dienine− (CHEBI:82934) has role fungal metabolite (CHEBI:76946) |
| β-D-glucosyl-(1↔1')-N-acyl-(4E,8E)-9-methylsphinga-4,8-dienine− (CHEBI:82934) is a β-D-glucosylceramide (CHEBI:83264) |
| UniProt Name | Source |
|---|---|
| N-acyl-β-D-glucosyl-(1↔1')-(4E,8E)-9-methyl-sphinga-4,8-dienine | UniProt |
| Citations |
|---|