EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7NO4 |
| Net Charge | 0 |
| Average Mass | 169.136 |
| Monoisotopic Mass | 169.03751 |
| SMILES | O=C(O)CNC(=O)c1ccco1 |
| InChI | InChI=1S/C7H7NO4/c9-6(10)4-8-7(11)5-2-1-3-12-5/h1-3H,4H2,(H,8,11)(H,9,10) |
| InChIKey | KSPQDMRTZZYQLM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (4630229) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2-furoyl)glycine (CHEBI:82912) has functional parent 2-furoic acid (CHEBI:30845) |
| N-(2-furoyl)glycine (CHEBI:82912) has role human metabolite (CHEBI:77746) |
| N-(2-furoyl)glycine (CHEBI:82912) is a N-acylglycine (CHEBI:16180) |
| N-(2-furoyl)glycine (CHEBI:82912) is a furans (CHEBI:24129) |
| N-(2-furoyl)glycine (CHEBI:82912) is conjugate acid of N-(2-furoyl)glycinate (CHEBI:133665) |
| Incoming Relation(s) |
| N-(2-furoyl)glycinate (CHEBI:133665) is conjugate base of N-(2-furoyl)glycine (CHEBI:82912) |
| IUPAC Name |
|---|
| N-(furan-2-ylcarbonyl)glycine |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000439 | HMDB |
| Citations |
|---|