EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O4S |
| Net Charge | 0 |
| Average Mass | 230.285 |
| Monoisotopic Mass | 230.06128 |
| SMILES | Cc1ccc(C(C)C)c(OS(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H14O4S/c1-7(2)9-5-4-8(3)6-10(9)14-15(11,12)13/h4-7H,1-3H3,(H,11,12,13) |
| InChIKey | NODSEPOUFZPJEQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thymol sulfate (CHEBI:82911) has functional parent thymol (CHEBI:27607) |
| thymol sulfate (CHEBI:82911) has role human xenobiotic metabolite (CHEBI:76967) |
| thymol sulfate (CHEBI:82911) is a aryl sulfate (CHEBI:37919) |
| thymol sulfate (CHEBI:82911) is a monoterpenoid (CHEBI:25409) |
| thymol sulfate (CHEBI:82911) is conjugate acid of thymol sulfate(1−) (CHEBI:133663) |
| Incoming Relation(s) |
| thymol sulfate(1−) (CHEBI:133663) is conjugate base of thymol sulfate (CHEBI:82911) |
| IUPAC Name |
|---|
| 5-methyl-2-(propan-2-yl)phenyl hydrogen sulfate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3312332 | Reaxys |
| Citations |
|---|