EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16ClF2N3O |
| Net Charge | 0 |
| Average Mass | 327.762 |
| Monoisotopic Mass | 327.09500 |
| SMILES | CC[C@H](Nc1ncnc(C)c1Cl)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H16ClF2N3O/c1-3-12(21-14-13(16)9(2)19-8-20-14)10-4-6-11(7-5-10)22-15(17)18/h4-8,12,15H,3H2,1-2H3,(H,19,20,21)/t12-/m0/s1 |
| InChIKey | NEKULYKCZPJMMJ-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-diflumetorim (CHEBI:82868) is a 5-chloro-N-{1-[4-(difluoromethoxy)phenyl]propyl}-6-methylpyrimidin-4-amine (CHEBI:82861) |
| (S)-diflumetorim (CHEBI:82868) is enantiomer of (R)-diflumetorim (CHEBI:82867) |
| Incoming Relation(s) |
| diflumetorim (CHEBI:82860) has part (S)-diflumetorim (CHEBI:82868) |
| (R)-diflumetorim (CHEBI:82867) is enantiomer of (S)-diflumetorim (CHEBI:82868) |
| IUPAC Name |
|---|
| 5-chloro-N-{(1S)-1-[4-(difluoromethoxy)phenyl]propyl}-6-methylpyrimidin-4-amine |