EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N4OS2 |
| Net Charge | 0 |
| Average Mass | 320.443 |
| Monoisotopic Mass | 320.07655 |
| SMILES | CCNc1nc(CC)c(C(=O)N[C@@H](C#N)c2cccs2)s1 |
| InChI | InChI=1S/C14H16N4OS2/c1-3-9-12(21-14(18-9)16-4-2)13(19)17-10(8-15)11-6-5-7-20-11/h5-7,10H,3-4H2,1-2H3,(H,16,18)(H,17,19)/t10-/m0/s1 |
| InChIKey | NQRFDNJEBWAUBL-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-ethaboxam (CHEBI:82858) is a N-[cyano(2-thienyl)methyl]-4-ethyl-2-(ethylamino)-1,3-thiazole-5-carboxamide (CHEBI:82857) |
| (S)-ethaboxam (CHEBI:82858) is enantiomer of (R)-ethaboxam (CHEBI:82859) |
| Incoming Relation(s) |
| ethaboxam (CHEBI:82856) has part (S)-ethaboxam (CHEBI:82858) |
| (R)-ethaboxam (CHEBI:82859) is enantiomer of (S)-ethaboxam (CHEBI:82858) |
| IUPAC Name |
|---|
| N-[(S)-cyano(2-thienyl)methyl]-4-ethyl-2-(ethylamino)-1,3-thiazole-5-carboxamide |
| Citations |
|---|