EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16Cl3NO2 |
| Net Charge | 0 |
| Average Mass | 336.646 |
| Monoisotopic Mass | 335.02466 |
| SMILES | CC[C@](C)(NC(=O)c1cc(Cl)c(C)c(Cl)c1)C(=O)CCl |
| InChI | InChI=1S/C14H16Cl3NO2/c1-4-14(3,12(19)7-15)18-13(20)9-5-10(16)8(2)11(17)6-9/h5-6H,4,7H2,1-3H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | SOUGWDPPRBKJEX-AWEZNQCLSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-zoxamide (CHEBI:82854) is a 3,5-dichloro-N-(1-chloro-3-methyl-2-oxopentan-3-yl)-4-methylbenzamide (CHEBI:82853) |
| (S)-zoxamide (CHEBI:82854) is enantiomer of (R)-zoxamide (CHEBI:82855) |
| Incoming Relation(s) |
| zoxamide (CHEBI:82048) has part (S)-zoxamide (CHEBI:82854) |
| (R)-zoxamide (CHEBI:82855) is enantiomer of (S)-zoxamide (CHEBI:82854) |
| IUPAC Name |
|---|
| 3,5-dichloro-N-[(3S)-1-chloro-3-methyl-2-oxopentan-3-yl]-4-methylbenzamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13257723 | Reaxys |