EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H50O2 |
| Net Charge | 0 |
| Average Mass | 394.684 |
| Monoisotopic Mass | 394.38108 |
| SMILES | CCCCCCCCCCCCCCCC/C=C\CCCCCCCC(=O)O |
| InChI | InChI=1S/C26H50O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28/h17-18H,2-16,19-25H2,1H3,(H,27,28)/b18-17- |
| InChIKey | WCVLVNLRVRJFLN-ZCXUNETKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9Z)-hexacosenoic acid (CHEBI:82836) is a hexacosenoic acid (CHEBI:78865) |
| (9Z)-hexacosenoic acid (CHEBI:82836) is conjugate acid of (9Z)-hexacosenoate (CHEBI:78808) |
| Incoming Relation(s) |
| (9Z)-hexacosenoate (CHEBI:78808) is conjugate base of (9Z)-hexacosenoic acid (CHEBI:82836) |
| IUPAC Name |
|---|
| (9Z)-hexacos-9-enoic acid |
| Synonyms | Source |
|---|---|
| 9Z-hexacosenoic acid | LIPID MAPS |
| C26:1n-17 | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030423 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1714560 | Reaxys |