EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,15-16H,2,5,8,11-14,17-19H2,1H3,(H,21,22)/b4-3-,7-6-,10-9-,16-15- |
| InChIKey | JDKIKEYFSJUYJZ-OUJQXAOTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Juniperus (ncbitaxon:13100) | - | PubMed (22908582) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Caenorhabditis elegans metabolite A nematode metabolite produced by Caenorhabditis elegans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5Z,11Z,14Z,17Z)-icosatetraenoic acid (CHEBI:82835) has role plant metabolite (CHEBI:76924) |
| (5Z,11Z,14Z,17Z)-icosatetraenoic acid (CHEBI:82835) is a icosatetraenoic acid (CHEBI:36033) |
| (5Z,11Z,14Z,17Z)-icosatetraenoic acid (CHEBI:82835) is conjugate acid of (5Z,11Z,14Z,17Z)-icosatetraenoate (CHEBI:78806) |
| Incoming Relation(s) |
| (5Z,11Z,14Z,17Z)-icosatetraenoate (CHEBI:78806) is conjugate base of (5Z,11Z,14Z,17Z)-icosatetraenoic acid (CHEBI:82835) |
| Synonyms | Source |
|---|---|
| (5Z,11Z,14Z,17Z)-eicosatetraenoic acid | ChEBI |
| 5Z,11Z,14Z,17Z-eicosatetraenoic acid | LIPID MAPS |
| C20:4n-3,6,9,15 | LIPID MAPS |
| all-cis-5,11,14,17-eicosatetraenoic acid | ChEBI |
| all-cis-5,11,14,17-icosatetraenoic acid | ChEBI |
| Juniperonic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030394 | LIPID MAPS |
| Citations |
|---|