EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O2 |
| Net Charge | 0 |
| Average Mass | 306.490 |
| Monoisotopic Mass | 306.25588 |
| SMILES | CCCCC/C=C\C/C=C\CCCC/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6-7,9-10,15-16H,2-5,8,11-14,17-19H2,1H3,(H,21,22)/b7-6-,10-9-,16-15- |
| InChIKey | PRHHYVQTPBEDFE-URZBRJKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nageia nagi (ncbitaxon:36012) | - | PubMed (22889893) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5Z,11Z,14Z)-icosatrienoic acid (CHEBI:82832) has role anti-inflammatory agent (CHEBI:67079) |
| (5Z,11Z,14Z)-icosatrienoic acid (CHEBI:82832) has role plant metabolite (CHEBI:76924) |
| (5Z,11Z,14Z)-icosatrienoic acid (CHEBI:82832) is a fatty acid 20:3 (CHEBI:36036) |
| (5Z,11Z,14Z)-icosatrienoic acid (CHEBI:82832) is conjugate acid of (5Z,11Z,14Z)-icosatrienoate (CHEBI:78807) |
| Incoming Relation(s) |
| (5Z,11Z,14Z)-icosatrienoate (CHEBI:78807) is conjugate base of (5Z,11Z,14Z)-icosatrienoic acid (CHEBI:82832) |
| IUPAC Name |
|---|
| (5Z,11Z,14Z)-icosa-5,11,14-trienoic acid |
| Synonyms | Source |
|---|---|
| (5Z,11Z,14Z)-eicosatrienoic acid | ChEBI |
| 5Z,11Z,14Z-eicosatrienoic acid | LIPID MAPS |
| C20:3n-6,9,15 | LIPID MAPS |
| all-cis-5,11,14-eicosatrienoic acid | ChEBI |
| all-cis-5,11,14-icosatrienoic acid | ChEBI |
| Sciadonic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030380 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1713305 | Reaxys |
| Citations |
|---|