EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C53H82O24S |
| Net Charge | 0 |
| Average Mass | 1135.282 |
| Monoisotopic Mass | 1134.49167 |
| SMILES | [H][C@]12C(=O)C[C@]3(C)[C@@]1(CC=C1[C@@]3([H])CC[C@@]3([H])C(C)(C)[C@@H](O[C@@H]4OC[C@@H](OS(=O)(=O)O)[C@H](O)[C@H]4O[C@@H]4O[C@H](C)[C@@H](O[C@@H]5OC[C@@H](O)[C@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](OC)[C@H]6O)[C@H]5O)[C@H](O)[C@H]4O)CC[C@]13C)C(=O)O[C@@]2(C)CCCC(=C)C |
| InChI | InChI=1S/C53H82O24S/c1-23(2)11-10-16-52(8)43-27(55)19-51(7)26-12-13-31-49(4,5)32(15-17-50(31,6)25(26)14-18-53(43,51)48(63)76-52)72-47-42(34(58)30(22-69-47)77-78(64,65)66)75-45-36(60)35(59)39(24(3)70-45)73-44-37(61)40(28(56)21-68-44)74-46-38(62)41(67-9)33(57)29(20-54)71-46/h14,24,26,28-47,54,56-62H,1,10-13,15-22H2,2-9H3,(H,64,65,66)/t24-,26-,28-,29-,30-,31+,32+,33-,34+,35-,36-,37-,38-,39-,40+,41+,42-,43-,44+,45+,46+,47+,50-,51+,52+,53-/m1/s1 |
| InChIKey | OQBFQOOZNQRQAW-INFQXDPISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Australostichopus mollis (ncbitaxon:576896) | - | PubMed (22271309) |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neothyonidioside (CHEBI:82825) has parent hydride lanostane (CHEBI:20265) |
| neothyonidioside (CHEBI:82825) has role antifungal agent (CHEBI:35718) |
| neothyonidioside (CHEBI:82825) has role marine metabolite (CHEBI:76507) |
| neothyonidioside (CHEBI:82825) is a lactone (CHEBI:25000) |
| neothyonidioside (CHEBI:82825) is a olefinic compound (CHEBI:78840) |
| neothyonidioside (CHEBI:82825) is a oligosaccharide sulfate (CHEBI:37909) |
| neothyonidioside (CHEBI:82825) is a pentacyclic triterpenoid (CHEBI:25872) |
| neothyonidioside (CHEBI:82825) is a tetrasaccharide derivative (CHEBI:63567) |
| neothyonidioside (CHEBI:82825) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| (3β)-16,18-dioxo-18,20-epoxylanosta-9(11),25-dien-3-yl 3-O-methyl-β-D-glucopyranosyl-(1→3)-β-D-xylopyranosyl-(1→4)-6-deoxy-β-D-glucopyranosyl-(1→2)-4-O-sulfo-β-D-xylopyranoside |
| Citations |
|---|