EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C53H82O24S |
| Net Charge | 0 |
| Average Mass | 1135.282 |
| Monoisotopic Mass | 1134.49167 |
| SMILES | [H][C@]12C(=O)C[C@]3(C)[C@@]1(CC=C1[C@@]3([H])CC[C@@]3([H])C(C)(C)[C@@H](O[C@@H]4OC[C@@H](OS(=O)(=O)O)[C@H](O)[C@H]4O[C@@H]4O[C@H](C)[C@@H](O[C@@H]5OC[C@@H](O)[C@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](OC)[C@H]6O)[C@H]5O)[C@H](O)[C@H]4O)CC[C@]13C)C(=O)O[C@@]2(C)CCCC(=C)C |
| InChI | InChI=1S/C53H82O24S/c1-23(2)11-10-16-52(8)43-27(55)19-51(7)26-12-13-31-49(4,5)32(15-17-50(31,6)25(26)14-18-53(43,51)48(63)76-52)72-47-42(34(58)30(22-69-47)77-78(64,65)66)75-45-36(60)35(59)39(24(3)70-45)73-44-37(61)40(28(56)21-68-44)74-46-38(62)41(67-9)33(57)29(20-54)71-46/h14,24,26,28-47,54,56-62H,1,10-13,15-22H2,2-9H3,(H,64,65,66)/t24-,26-,28-,29-,30-,31+,32+,33-,34+,35-,36-,37-,38-,39-,40+,41+,42-,43-,44+,45+,46+,47+,50-,51+,52+,53-/m1/s1 |
| InChIKey | OQBFQOOZNQRQAW-INFQXDPISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Australostichopus mollis (ncbitaxon:576896) | - | PubMed (22271309) |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neothyonidioside (CHEBI:82825) has parent hydride lanostane (CHEBI:20265) |
| neothyonidioside (CHEBI:82825) has role antifungal agent (CHEBI:35718) |
| neothyonidioside (CHEBI:82825) has role marine metabolite (CHEBI:76507) |
| neothyonidioside (CHEBI:82825) is a lactone (CHEBI:25000) |
| neothyonidioside (CHEBI:82825) is a olefinic compound (CHEBI:78840) |
| neothyonidioside (CHEBI:82825) is a oligosaccharide sulfate (CHEBI:37909) |
| neothyonidioside (CHEBI:82825) is a pentacyclic triterpenoid (CHEBI:25872) |
| neothyonidioside (CHEBI:82825) is a tetrasaccharide derivative (CHEBI:63567) |
| neothyonidioside (CHEBI:82825) is a triterpenoid saponin (CHEBI:61778) |
| IUPAC Name |
|---|
| (3β)-16,18-dioxo-18,20-epoxylanosta-9(11),25-dien-3-yl 3-O-methyl-β-D-glucopyranosyl-(1→3)-β-D-xylopyranosyl-(1→4)-6-deoxy-β-D-glucopyranosyl-(1→2)-4-O-sulfo-β-D-xylopyranoside |
| Citations |
|---|