EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O4 |
| Net Charge | 0 |
| Average Mass | 382.460 |
| Monoisotopic Mass | 382.18926 |
| SMILES | [H]C(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C22H26N2O4/c1-16(2)20(24-22(27)28-15-18-11-7-4-8-12-18)21(26)23-19(14-25)13-17-9-5-3-6-10-17/h3-12,14,16,19-20H,13,15H2,1-2H3,(H,23,26)(H,24,27)/t19-,20-/m0/s1 |
| InChIKey | NGBKFLTYGSREKK-PMACEKPBSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.22.52 (calpain-1) inhibitor A calpain inhibitor that interferes with the action of calpain-1 (EC 3.4.22.52). EC 3.4.22.53 (calpain-2) inhibitor A calpain inhibitor that interferes with the action of calpain-2 (EC 3.4.22.53). EC 3.4.23.46 (memapsin 2) inhibitor An EC 3.4.23.* (aspartic endopeptidase) inhibitor that interferes with the activity of memapsin 2 (EC 3.4.23.46). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MDL-28170 (CHEBI:82818) has role anticoronaviral agent (CHEBI:149553) |
| MDL-28170 (CHEBI:82818) has role antileishmanial agent (CHEBI:70868) |
| MDL-28170 (CHEBI:82818) has role apoptosis inhibitor (CHEBI:68494) |
| MDL-28170 (CHEBI:82818) has role EC 3.4.22.52 (calpain-1) inhibitor (CHEBI:79050) |
| MDL-28170 (CHEBI:82818) has role EC 3.4.22.53 (calpain-2) inhibitor (CHEBI:82821) |
| MDL-28170 (CHEBI:82818) has role EC 3.4.23.46 (memapsin 2) inhibitor (CHEBI:74925) |
| MDL-28170 (CHEBI:82818) is a aldehyde (CHEBI:17478) |
| MDL-28170 (CHEBI:82818) is a carbamate ester (CHEBI:23003) |
| MDL-28170 (CHEBI:82818) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| benzyl [(2S)-3-methyl-1-oxo-1-{[(2S)-1-oxo-3-phenylpropan-2-yl]amino}butan-2-yl]carbamate |
| Synonyms | Source |
|---|---|
| calpain inhibitor III | ChemIDplus |
| carbobenzoxyvalylphenylalanine aldehyde | ChemIDplus |
| Cbz-Val-Phe-H | ChemIDplus |
| Cbz-Val-Phe-H | ChEBI |
| CbzValPheH | ChEBI |
| N-benzyloxycarbonyl-L-valyl-L-phenylalaninal | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-2958 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6824325 | Reaxys |
| CAS:88191-84-8 | ChemIDplus |
| Citations |
|---|