EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O4 |
| Net Charge | 0 |
| Average Mass | 382.460 |
| Monoisotopic Mass | 382.18926 |
| SMILES | [H]C(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C22H26N2O4/c1-16(2)20(24-22(27)28-15-18-11-7-4-8-12-18)21(26)23-19(14-25)13-17-9-5-3-6-10-17/h3-12,14,16,19-20H,13,15H2,1-2H3,(H,23,26)(H,24,27)/t19-,20-/m0/s1 |
| InChIKey | NGBKFLTYGSREKK-PMACEKPBSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.4.22.53 (calpain-2) inhibitor A calpain inhibitor that interferes with the action of calpain-2 (EC 3.4.22.53). apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. EC 3.4.22.52 (calpain-1) inhibitor A calpain inhibitor that interferes with the action of calpain-1 (EC 3.4.22.52). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. EC 3.4.23.46 (memapsin 2) inhibitor An EC 3.4.23.* (aspartic endopeptidase) inhibitor that interferes with the activity of memapsin 2 (EC 3.4.23.46). |
| Application: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MDL-28170 (CHEBI:82818) has role anticoronaviral agent (CHEBI:149553) |
| MDL-28170 (CHEBI:82818) has role antileishmanial agent (CHEBI:70868) |
| MDL-28170 (CHEBI:82818) has role apoptosis inhibitor (CHEBI:68494) |
| MDL-28170 (CHEBI:82818) has role EC 3.4.22.52 (calpain-1) inhibitor (CHEBI:79050) |
| MDL-28170 (CHEBI:82818) has role EC 3.4.22.53 (calpain-2) inhibitor (CHEBI:82821) |
| MDL-28170 (CHEBI:82818) has role EC 3.4.23.46 (memapsin 2) inhibitor (CHEBI:74925) |
| MDL-28170 (CHEBI:82818) is a aldehyde (CHEBI:17478) |
| MDL-28170 (CHEBI:82818) is a carbamate ester (CHEBI:23003) |
| MDL-28170 (CHEBI:82818) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| benzyl [(2S)-3-methyl-1-oxo-1-{[(2S)-1-oxo-3-phenylpropan-2-yl]amino}butan-2-yl]carbamate |
| Synonyms | Source |
|---|---|
| carbobenzoxyvalylphenylalanine aldehyde | ChemIDplus |
| Cbz-Val-Phe-H | ChemIDplus |
| L-benzyloxycarbonyl-L-valyl-L-phenylalaninal | ChEBI |
| calpain inhibitor III | ChemIDplus |
| N-benzyloxycarbonylvalylphenylalanine aldehyde | ChemIDplus |
| N-benzyloxycarbonylvalylphenylalaninal | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-2958 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6824325 | Reaxys |
| CAS:88191-84-8 | ChemIDplus |
| Citations |
|---|