EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | C=C(C)[C@H]1C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC1 |
| InChI | InChI=1S/C20H32/c1-16(2)20-14-12-18(4)10-6-8-17(3)9-7-11-19(5)13-15-20/h8,11-12,20H,1,6-7,9-10,13-15H2,2-5H3/b17-8+,18-12+,19-11+/t20-/m0/s1 |
| InChIKey | VWSPQDDPRITBAM-KPGNMOGWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alligator sinensis (ncbitaxon:38654) | - | PubMed (9287418) | |
| Cephalotaxus sinensis (ncbitaxon:89484) | - | PubMed (37326357) |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-cembrene A (CHEBI:82800) has parent hydride cembrane (CHEBI:60689) |
| (R)-cembrene A (CHEBI:82800) has role animal metabolite (CHEBI:75767) |
| (R)-cembrene A (CHEBI:82800) has role bacterial metabolite (CHEBI:76969) |
| (R)-cembrene A (CHEBI:82800) has role coral metabolite (CHEBI:76498) |
| (R)-cembrene A (CHEBI:82800) has role plant metabolite (CHEBI:76924) |
| (R)-cembrene A (CHEBI:82800) is a cycloalkatriene (CHEBI:36402) |
| (R)-cembrene A (CHEBI:82800) is a diterpene (CHEBI:35190) |
| (R)-cembrene A (CHEBI:82800) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (1E,5E,9E,12R)-1,5,9-trimethyl-12-(prop-1-en-2-yl)cyclotetradeca-1,5,9-triene |
| Synonyms | Source |
|---|---|
| 1,5,9-Trimethyl-12-(1-methylethenyl)-1,5,9-cyclotetradecatriene | ChemIDplus |
| (-)-Cembrene A | ChemIDplus |
| Cembrene A | KEGG COMPOUND |
| (−)-R-cembrene A | ChEBI |
| Neocembrene | KEGG COMPOUND |
| (R)-(-)-Cembrene A | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (R)-cembrene A | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003458 | KNApSAcK |
| C09140 | KEGG COMPOUND |
| Cembrene_A | Wikipedia |
| CPD-16930 | MetaCyc |
| LMPR0104190001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2215256 | Reaxys |
| CAS:31570-39-5 | ChemIDplus |
| CAS:31570-39-5 | NIST Chemistry WebBook |
| Citations |
|---|