EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | C/C1=C\CC/C(C)=C/C[C@H](C(C)(C)O)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C20H34O/c1-16-8-6-10-17(2)12-14-19(20(4,5)21)15-13-18(3)11-7-9-16/h8,11-12,19,21H,6-7,9-10,13-15H2,1-5H3/b16-8+,17-12+,18-11+/t19-/m0/s1 |
| InChIKey | ZJWQYSDAWSDJRA-QPHFJTKNSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-nephthenol (CHEBI:82799) has functional parent cembrene C (CHEBI:82798) |
| (R)-nephthenol (CHEBI:82799) has role bacterial metabolite (CHEBI:76969) |
| (R)-nephthenol (CHEBI:82799) has role coral metabolite (CHEBI:76498) |
| (R)-nephthenol (CHEBI:82799) is a cembrane diterpenoid (CHEBI:60687) |
| (R)-nephthenol (CHEBI:82799) is a macrocycle (CHEBI:51026) |
| (R)-nephthenol (CHEBI:82799) is a olefinic compound (CHEBI:78840) |
| (R)-nephthenol (CHEBI:82799) is a tertiary alcohol (CHEBI:26878) |
| (R)-nephthenol (CHEBI:82799) is enantiomer of (S)-nephthenol (CHEBI:193073) |
| Incoming Relation(s) |
| (S)-nephthenol (CHEBI:193073) is enantiomer of (R)-nephthenol (CHEBI:82799) |
| IUPAC Name |
|---|
| 2-[(1R,3E,7E,11E)-4,8,12-trimethylcyclotetradeca-3,7,11-trien-1-yl]propan-2-ol |
| Synonyms | Source |
|---|---|
| (-)-Nephthenol | KNApSAcK |
| Nephthenol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (R)-nephthenol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4189963 | Reaxys |
| CAS:53915-41-6 | ChemIDplus |
| Citations |
|---|