EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23NO3 |
| Net Charge | 0 |
| Average Mass | 325.408 |
| Monoisotopic Mass | 325.16779 |
| SMILES | COC(=O)[C@@H](C)N(C(=O)Cc1ccccc1)c1c(C)cccc1C |
| InChI | InChI=1S/C20H23NO3/c1-14-9-8-10-15(2)19(14)21(16(3)20(23)24-4)18(22)13-17-11-6-5-7-12-17/h5-12,16H,13H2,1-4H3/t16-/m1/s1 |
| InChIKey | CJPQIRJHIZUAQP-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Biological Roles: | fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungicide A substance used to destroy fungal pests. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benalaxyl-M (CHEBI:82779) is a D-alanine derivative (CHEBI:83944) |
| benalaxyl-M (CHEBI:82779) is a acylamino acid fungicide (CHEBI:87013) |
| benalaxyl-M (CHEBI:82779) is a anilide fungicide (CHEBI:87015) |
| benalaxyl-M (CHEBI:82779) is a methyl N-(2,6-dimethylphenyl)-N-(phenylacetyl)alaninate (CHEBI:82777) |
| benalaxyl-M (CHEBI:82779) is enantiomer of (S)-benalaxyl (CHEBI:82782) |
| Incoming Relation(s) |
| benalaxyl (CHEBI:3009) has part benalaxyl-M (CHEBI:82779) |
| (S)-benalaxyl (CHEBI:82782) is enantiomer of benalaxyl-M (CHEBI:82779) |
| IUPAC Name |
|---|
| methyl N-(2,6-dimethylphenyl)-N-(phenylacetyl)-D-alaninate |
| Synonyms | Source |
|---|---|
| (-)-R-Benalaxyl | ChemIDplus |
| D-Benalaxyl | ChemIDplus |
| IR 6141 | ChemIDplus |
| Kiralaxyl | ChemIDplus |
| methyl N-(phenylacetyl)-N-(2,6-xylyl)-D-alaninate | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| benalaxyl-m | Alan Wood's Pesticides |
| US2008293707 | Patent |
| NZ575703 | Patent |
| WO2011108751 | Patent |
| WO2007031283 | Patent |
| 1010 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11327124 | Reaxys |
| CAS:98243-83-5 | ChemIDplus |
| Citations |
|---|