EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13O8P |
| Net Charge | -2 |
| Average Mass | 304.191 |
| Monoisotopic Mass | 304.03590 |
| SMILES | O=P([O-])([O-])OC[C@H]1O[C@@H](c2ccc(O)cc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H15O8P/c12-7-3-1-6(2-4-7)11-10(14)9(13)8(19-11)5-18-20(15,16)17/h1-4,8-14H,5H2,(H2,15,16,17)/p-2/t8-,9-,10-,11+/m1/s1 |
| InChIKey | PXLPZQRJCCAXJV-DBIOUOCHSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(5-O-phosphonato-β-D-ribofuranosyl)phenol(2−) (CHEBI:82767) has functional parent D-ribofuranose 5-phosphate(2−) (CHEBI:78346) |
| 4-(5-O-phosphonato-β-D-ribofuranosyl)phenol(2−) (CHEBI:82767) is a organophosphate oxoanion (CHEBI:58945) |
| 4-(5-O-phosphonato-β-D-ribofuranosyl)phenol(2−) (CHEBI:82767) is conjugate base of 4-(5-O-phospho-β-D-ribofuranosyl)phenol (CHEBI:83444) |
| Incoming Relation(s) |
| 4-(5-O-phospho-β-D-ribofuranosyl)phenol (CHEBI:83444) is conjugate acid of 4-(5-O-phosphonato-β-D-ribofuranosyl)phenol(2−) (CHEBI:82767) |
| IUPAC Name |
|---|
| (1S)-1,4-anhydro-1-(4-hydroxyphenyl)-5-O-phosphonato-D-ribitol |
| UniProt Name | Source |
|---|---|
| 4-(β-D-ribofuranosyl)phenol 5'-phosphate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16964 | MetaCyc |
| Citations |
|---|