EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:82766 - 2-O-(α-D-glucopyranosyl)glycerol
| Formula | C9H18O8 |
| Net Charge | 0 |
| Average Mass | 254.235 |
| Monoisotopic Mass | 254.10017 |
| SMILES | OCC(CO)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/2,2,1/[hxh][a2122h-1a_1-5]/1-2/a2-b1 |
| InChI | InChI=1S/C9H18O8/c10-1-4(2-11)16-9-8(15)7(14)6(13)5(3-12)17-9/h4-15H,1-3H2/t5-,6-,7+,8-,9+/m1/s1 |
| InChIKey | AQTKXCPRNZDOJU-ZEBDFXRSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leuconostoc mesenteroides (ncbitaxon:1245) | - | PubMed (19025748) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. osmolyte A solute used by a cell under water stress to maintain cell volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-O-(α-D-glucopyranosyl)glycerol (CHEBI:82766) has role bacterial metabolite (CHEBI:76969) |
| 2-O-(α-D-glucopyranosyl)glycerol (CHEBI:82766) has role osmolyte (CHEBI:25728) |
| 2-O-(α-D-glucopyranosyl)glycerol (CHEBI:82766) is a glucosylglycerol (CHEBI:24287) |
| 2-O-(α-D-glucopyranosyl)glycerol (CHEBI:82766) is a α-D-glucoside (CHEBI:22390) |
| IUPAC Name |
|---|
| 1,3-dihydroxypropan-2-yl α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2-O-(α-D-glucosyl)glycerol | SUBMITTER |
| 2-glyceryl α-D-glucopyranoside | ChEBI |
| (2S,3R,4S,5S,6R)-2-(1,3-dihydroxypropan-2-yloxy)-6-(hydroxymethyl)oxane-3,4,5-triol | IUPAC |
| UniProt Name | Source |
|---|---|
| 2-O-(α-D-glucopyranosyl)glycerol | UniProt |
| Citations |
|---|