EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N3O |
| Net Charge | 0 |
| Average Mass | 323.440 |
| Monoisotopic Mass | 323.19976 |
| SMILES | CCCCCC1=C/C(=C/c2nc(-c3cccn3)cc2OC)N=C1C |
| InChI | InChI=1S/C20H25N3O/c1-4-5-6-8-15-11-16(22-14(15)2)12-19-20(24-3)13-18(23-19)17-9-7-10-21-17/h7,9-13,21,23H,4-6,8H2,1-3H3/b16-12- |
| InChIKey | SZXDNGVQRDTJSD-VBKFSLOCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Serratia marcescens (ncbitaxon:615) | - | PubMed (15853884) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prodigiosin (CHEBI:82758) has role antimicrobial agent (CHEBI:33281) |
| prodigiosin (CHEBI:82758) has role antineoplastic agent (CHEBI:35610) |
| prodigiosin (CHEBI:82758) has role apoptosis inducer (CHEBI:68495) |
| prodigiosin (CHEBI:82758) has role bacterial metabolite (CHEBI:76969) |
| prodigiosin (CHEBI:82758) has role biological pigment (CHEBI:26130) |
| prodigiosin (CHEBI:82758) is a aromatic ether (CHEBI:35618) |
| prodigiosin (CHEBI:82758) is a ring assembly (CHEBI:36820) |
| prodigiosin (CHEBI:82758) is a tripyrrole (CHEBI:36317) |
| IUPAC Name |
|---|
| 4-methoxy-5-[(Z)-(5-methyl-4-pentyl-2H-pyrrol-2-ylidene)methyl]-1H,1'H-2,2'-bipyrrole |
| Synonym | Source |
|---|---|
| 4-Methoxy-5-((5-methyl-4-pentyl-2H-pyrrol-2-ylidene)methyl)-2,2'-bipyrrole | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| CPD-16992 | MetaCyc |
| Prodigiosin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4526727 | Reaxys |
| CAS:82-89-3 | ChemIDplus |
| Citations |
|---|