EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H8O3 |
| Net Charge | 0 |
| Average Mass | 188.182 |
| Monoisotopic Mass | 188.04734 |
| SMILES | CC1=CC(=O)c2c(O)cccc2C1=O |
| InChI | InChI=1S/C11H8O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-5,12H,1H3 |
| InChIKey | VCMMXZQDRFWYSE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Juglans cinerea (ncbitaxon:91214) | |||
| bark (BTO:0001301) | PubMed (14727919) | ||
| xylem (BTO:0001468) | PubMed (14727919) | Previous component: wood; | |
| root (BTO:0001188) | PubMed (14727919) | ||
| leaf (BTO:0000713) | PubMed (14727919) | ||
| Juglans nigra (ncbitaxon:16719) | |||
| root (BTO:0001188) | PubMed (14727919) | ||
| leaf (BTO:0000713) | PubMed (14727919) | ||
| bark (BTO:0001301) | PubMed (14727919) | ||
| xylem (BTO:0001468) | PubMed (14727919) | Previous component: wood; | |
| Juglans regia (ncbitaxon:51240) | |||
| xylem (BTO:0001468) | PubMed (14727919) | Previous component: wood; | |
| bark (BTO:0001301) | PubMed (14727919) | ||
| leaf (BTO:0000713) | PubMed (14727919) | ||
| root (BTO:0001188) | PubMed (14727919) | ||
| Nepenthes thorelii (ncbitaxon:122314) | root (BTO:0001188) | PubMed (9581522) | |
| Plumbago europaea (ncbitaxon:114226) | root (BTO:0001188) | DOI (10.2225/vol5-issue3-fulltext-4) | |
| Plumbago rosea (IPNI:687095-1) | root (BTO:0001188) | DOI (10.2225/vol5-issue3-fulltext-4) | |
| Plumbago scandens (IPNI:30243613-2) | root (BTO:0001188) | PubMed (14762525) | |
| Plumbago zeylanica (ncbitaxon:76149) | root (BTO:0001188) | PubMed (16078700) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticoagulant An agent that prevents blood clotting. immunological adjuvant A substance that augments, stimulates, activates, potentiates, or modulates the immune response at either the cellular or humoral level. A classical agent (Freund's adjuvant, BCG, Corynebacterium parvum, et al.) contains bacterial antigens. It could also be endogenous (e.g., histamine, interferon, transfer factor, tuftsin, interleukin-1). Its mode of action is either non-specific, resulting in increased immune responsiveness to a wide variety of antigens, or antigen-specific, i.e., affecting a restricted type of immune response to a narrow group of antigens. The therapeutic efficacy is related to its antigen-specific immunoadjuvanticity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plumbagin (CHEBI:8273) has role anticoagulant (CHEBI:50249) |
| plumbagin (CHEBI:8273) has role antineoplastic agent (CHEBI:35610) |
| plumbagin (CHEBI:8273) has role immunological adjuvant (CHEBI:50847) |
| plumbagin (CHEBI:8273) has role metabolite (CHEBI:25212) |
| plumbagin (CHEBI:8273) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| plumbagin (CHEBI:8273) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 5-hydroxy-2-methylnaphthalene-1,4-dione |
| Synonyms | Source |
|---|---|
| 2-methyl-5-hydroxy-1,4-naphthoquinone | ChemIDplus |
| 2-methyljuglone | ChEBI |
| 5-hydroxy-2-methyl-1,4-naphthalenedione | ChemIDplus |
| 5-hydroxy-2-methyl-1,4-naphthoquinone | ChEBI |
| plumbaein | ChEBI |
| Plumbagin | KEGG COMPOUND |
| Citations |
|---|