EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C88H100Cl2N10O28 |
| Net Charge | 0 |
| Average Mass | 1816.716 |
| Monoisotopic Mass | 1814.60856 |
| SMILES | CN[C@H]1C(=O)N[C@@H]2Cc3ccc(cc3)Oc3cc4cc(c3O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3NC(=O)CCCCCCCCC(C)C)Oc3ccc(cc3Cl)[C@@H](O)[C@@H]3NC(=O)[C@H](NC(=O)[C@@H]4NC(=O)[C@@H](NC2=O)c2cc(cc(O)c2Cl)Oc2cc1ccc2O)c1ccc(O)c(c1)-c1c(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]2O)cc(O)cc1[C@@H](C(=O)NCCCN(C)C)NC3=O |
| InChI | InChI=1S/C88H100Cl2N10O28/c1-38(2)13-10-8-6-7-9-11-14-61(106)94-70-73(109)75(111)78(86(120)121)128-87(70)127-77-58-31-43-32-59(77)124-55-24-19-42(29-50(55)89)71(107)69-85(119)98-67(80(114)92-25-12-26-100(4)5)48-33-44(102)34-57(125-88-76(112)74(110)72(108)60(37-101)126-88)62(48)47-28-40(17-22-52(47)103)65(82(116)99-69)95-83(117)66(43)96-84(118)68-49-35-46(36-54(105)63(49)90)123-56-30-41(18-23-53(56)104)64(91-3)81(115)93-51(79(113)97-68)27-39-15-20-45(122-58)21-16-39/h15-24,28-36,38,51,60,64-76,78,87-88,91,101-105,107-112H,6-14,25-27,37H2,1-5H3,(H,92,114)(H,93,115)(H,94,106)(H,95,117)(H,96,118)(H,97,113)(H,98,119)(H,99,116)(H,120,121)/t51-,60-,64-,65-,66-,67+,68+,69+,70-,71-,72-,73-,74+,75+,76+,78+,87-,88+/m1/s1 |
| InChIKey | KGPGQDLTDHGEGT-SZUNQUCBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dalbavancin (CHEBI:82721) has role antibacterial drug (CHEBI:36047) |
| dalbavancin (CHEBI:82721) has role antimicrobial agent (CHEBI:33281) |
| dalbavancin (CHEBI:82721) is a carbohydrate acid derivative (CHEBI:63436) |
| dalbavancin (CHEBI:82721) is a glycopeptide (CHEBI:24396) |
| dalbavancin (CHEBI:82721) is a monosaccharide derivative (CHEBI:63367) |
| dalbavancin (CHEBI:82721) is a semisynthetic derivative (CHEBI:72588) |
| INN | Source |
|---|---|
| dalbavancin | KEGG DRUG |
| Synonyms | Source |
|---|---|
| BI 397 | ChemIDplus |
| BI397 | ChemIDplus |
| dalbavancin B0 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 777 | DrugCentral |
| D03640 | KEGG DRUG |
| Dalbavancin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9839185 | Reaxys |
| CAS:171500-79-1 | ChemIDplus |
| CAS:171500-79-1 | KEGG DRUG |
| Citations |
|---|