EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H27ClO7 |
| Net Charge | 0 |
| Average Mass | 450.915 |
| Monoisotopic Mass | 450.14453 |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(O[C@H]4CCOC4)cc3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H27ClO7/c24-18-6-3-14(23-22(28)21(27)20(26)19(11-25)31-23)10-15(18)9-13-1-4-16(5-2-13)30-17-7-8-29-12-17/h1-6,10,17,19-23,25-28H,7-9,11-12H2/t17-,19+,20+,21-,22+,23-/m0/s1 |
| InChIKey | OBWASQILIWPZMG-QZMOQZSNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). antiviral agent A substance that destroys or inhibits replication of viruses. sodium-glucose transport protein subtype 2 inhibitor Any inhibitor that interferes with the action of sodium-glucose transport protein subtype 2. |
| Applications: | hyperglycemic agent A drug which increases the blood glucose level. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. renoprotective agent Any compound that is able to prevent damage to the kidneys. insulin-sensitizing drug An agent which overcomes insulin resistance by activation of the peroxisome proliferator activated receptor gamma (PPAR-gamma). hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-inflammatory agent Any compound that has anti-inflammatory effects. anticonvulsant A drug used to prevent seizures or reduce their severity. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| empagliflozin (CHEBI:82720) has role anti-inflammatory agent (CHEBI:67079) |
| empagliflozin (CHEBI:82720) has role anticonvulsant (CHEBI:35623) |
| empagliflozin (CHEBI:82720) has role antidepressant (CHEBI:35469) |
| empagliflozin (CHEBI:82720) has role antihypertensive agent (CHEBI:35674) |
| empagliflozin (CHEBI:82720) has role antineoplastic agent (CHEBI:35610) |
| empagliflozin (CHEBI:82720) has role antiviral agent (CHEBI:22587) |
| empagliflozin (CHEBI:82720) has role cardiovascular drug (CHEBI:35554) |
| empagliflozin (CHEBI:82720) has role hyperglycemic agent (CHEBI:76916) |
| empagliflozin (CHEBI:82720) has role hypoglycemic agent (CHEBI:35526) |
| empagliflozin (CHEBI:82720) has role insulin-sensitizing drug (CHEBI:50864) |
| empagliflozin (CHEBI:82720) has role renoprotective agent (CHEBI:231911) |
| empagliflozin (CHEBI:82720) has role sodium-glucose transport protein subtype 2 inhibitor (CHEBI:73273) |
| empagliflozin (CHEBI:82720) is a C-glycosyl compound (CHEBI:20857) |
| empagliflozin (CHEBI:82720) is a aromatic ether (CHEBI:35618) |
| empagliflozin (CHEBI:82720) is a monochlorobenzenes (CHEBI:83403) |
| empagliflozin (CHEBI:82720) is a tetrahydrofuryl ether (CHEBI:47814) |
| Incoming Relation(s) |
| Synjardy (CHEBI:90875) has part empagliflozin (CHEBI:82720) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-(4-chloro-3-{4-[(3S)-tetrahydrofuran-3-yloxy]benzyl}phenyl)-D-glucitol |
| INNs | Source |
|---|---|
| empagliflozina | WHO MedNet |
| empagliflozine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-chloro-4-(glucopyranos-1-yl)-2-(4-(tetrahydrofuran-3-yloxy)benzyl)benzene | ChemIDplus |
| (1S)-1,5-anhydro-1-C-{4-chloro-3-((4-{((3S)-oxolan-3-yl)oxy}phenyl)methyl)phenyl}-D-glucitol | ChemIDplus |
| BI 10773 | ChemIDplus |
| BI-10773 | ChemIDplus |
| BI10773 | ChemIDplus |
| empagliflozin | KEGG DRUG |
| Brand Names | Source |
|---|---|
| Empagliflozin component of glyxambi | ChEMBL |
| Empagliflozin component of synjardy | ChEMBL |
| Empagliflozin component of trijardy xr | ChEMBL |
| JARDIANCE | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4830 | DrugCentral |
| D10459 | KEGG DRUG |
| Empagliflozin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12378768 | Reaxys |
| CAS:864070-44-0 | ChemIDplus |
| CAS:864070-44-0 | KEGG DRUG |
| Citations |
|---|