EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22F2N4O |
| Net Charge | 0 |
| Average Mass | 348.397 |
| Monoisotopic Mass | 348.17617 |
| SMILES | C=C1CCN([C@H](C)[C@](O)(Cn2cncn2)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H22F2N4O/c1-13-5-7-23(8-6-13)14(2)18(25,10-24-12-21-11-22-24)16-4-3-15(19)9-17(16)20/h3-4,9,11-12,14,25H,1,5-8,10H2,2H3/t14-,18-/m1/s1 |
| InChIKey | NFEZZTICAUWDHU-RDTXWAMCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.14.13.70 (sterol 14alpha-demethylase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of EC 1.14.13.70 (sterol 14α-demethylase). antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| efinaconazole (CHEBI:82718) has role EC 1.14.13.70 (sterol 14α-demethylase) inhibitor (CHEBI:77884) |
| efinaconazole (CHEBI:82718) is a conazole antifungal drug (CHEBI:87071) |
| efinaconazole (CHEBI:82718) is a olefinic compound (CHEBI:78840) |
| efinaconazole (CHEBI:82718) is a organofluorine compound (CHEBI:37143) |
| efinaconazole (CHEBI:82718) is a piperidines (CHEBI:26151) |
| efinaconazole (CHEBI:82718) is a tertiary alcohol (CHEBI:26878) |
| efinaconazole (CHEBI:82718) is a tertiary amino compound (CHEBI:50996) |
| efinaconazole (CHEBI:82718) is a triazole antifungal drug (CHEBI:87101) |
| IUPAC Name |
|---|
| (2R,3R)-2-(2,4-difluorophenyl)-3-(4-methylenepiperidin-1-yl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol |
| INNs | Source |
|---|---|
| efinaconazol | WHO MedNet |
| efinaconazole | KEGG DRUG |
| éfinaconazole | WHO MedNet |
| efinaconazolum | WHO MedNet |
| Synonym | Source |
|---|---|
| KP-103 | ChemIDplus |
| Brand Name | Source |
|---|---|
| JUBLIA | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4874 | DrugCentral |
| D10021 | KEGG DRUG |
| Efinaconazole | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8582880 | Reaxys |
| CAS:164650-44-6 | ChemIDplus |
| CAS:164650-44-6 | KEGG DRUG |
| Citations |
|---|