EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15FN6O3 |
| Net Charge | 0 |
| Average Mass | 370.344 |
| Monoisotopic Mass | 370.11897 |
| SMILES | Cn1nnc(-c2ccc(-c3ccc(N4C[C@H](CO)OC4=O)cc3F)cn2)n1 |
| InChI | InChI=1S/C17H15FN6O3/c1-23-21-16(20-22-23)15-5-2-10(7-19-15)13-4-3-11(6-14(13)18)24-8-12(9-25)27-17(24)26/h2-7,12,25H,8-9H2,1H3/t12-/m1/s1 |
| InChIKey | XFALPSLJIHVRKE-GFCCVEGCSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tedizolid (CHEBI:82717) has role antimicrobial agent (CHEBI:33281) |
| tedizolid (CHEBI:82717) has role drug metabolite (CHEBI:49103) |
| tedizolid (CHEBI:82717) has role protein synthesis inhibitor (CHEBI:48001) |
| tedizolid (CHEBI:82717) is a carbamate ester (CHEBI:23003) |
| tedizolid (CHEBI:82717) is a organofluorine compound (CHEBI:37143) |
| tedizolid (CHEBI:82717) is a oxazolidinone (CHEBI:55374) |
| tedizolid (CHEBI:82717) is a primary alcohol (CHEBI:15734) |
| tedizolid (CHEBI:82717) is a pyridines (CHEBI:26421) |
| tedizolid (CHEBI:82717) is a tetrazoles (CHEBI:35689) |
| IUPAC Name |
|---|
| (5R)-3-{3-fluoro-4-[6-(2-methyl-2H-tetrazol-5-yl)pyridin-3-yl]phenyl}-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| INN | Source |
|---|---|
| tedizolid | KEGG DRUG |
| Synonyms | Source |
|---|---|
| TR 700 | ChemIDplus |
| TR-700 | ChemIDplus |
| DA-7157 | ChemIDplus |
| DA 7157 | ChemIDplus |
| Torezolid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10589936 | Reaxys |
| CAS:856866-72-3 | KEGG DRUG |
| CAS:856866-72-3 | ChemIDplus |
| Citations |
|---|