EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32N2O2 |
| Net Charge | 0 |
| Average Mass | 380.532 |
| Monoisotopic Mass | 380.24638 |
| SMILES | CCOC(CN1CCN(CC(C)C(=O)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O2/c1-3-28-23(21-10-6-4-7-11-21)19-26-16-14-25(15-17-26)18-20(2)24(27)22-12-8-5-9-13-22/h4-13,20,23H,3,14-19H2,1-2H3 |
| InChIKey | BSHWLCACYCVCJE-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | mucolytic A compound that alters the structure of mucus so as to decrease its viscosity and thereby facilitate its removal by ciliary action and expectoration. Compare with antitussives, which suppress the cough reflex, and expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eprazinone (CHEBI:82716) has role mucolytic (CHEBI:77034) |
| eprazinone (CHEBI:82716) is a N-alkylpiperazine (CHEBI:46845) |
| eprazinone (CHEBI:82716) is a aromatic ketone (CHEBI:76224) |
| eprazinone (CHEBI:82716) is a ether (CHEBI:25698) |
| eprazinone (CHEBI:82716) is conjugate base of eprazinone(2+) (CHEBI:83323) |
| Incoming Relation(s) |
| eprazinone(2+) (CHEBI:83323) is conjugate acid of eprazinone (CHEBI:82716) |
| IUPAC Name |
|---|
| 3-[4-(2-ethoxy-2-phenylethyl)piperazin-1-yl]-2-methyl-1-phenylpropan-1-one |
| INNs | Source |
|---|---|
| eprazinona | ChemIDplus |
| eprazinone | KEGG DRUG |
| éprazinone | ChEBI |
| eprazinonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-(2-Phenyl-2-ethoxyethyl)-4-(2-benzyloxypropyl)piperazine | ChemIDplus |
| 3-(4-(beta-Ethoxyphenethyl)-1-piperazinyl)-2-methylpropiophenone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1035 | DrugCentral |
| CN1602869 | Patent |
| D07902 | KEGG DRUG |
| DB08990 | DrugBank |
| Eprazinone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:844684 | Reaxys |
| CAS:10402-90-1 | ChemIDplus |
| CAS:10402-90-1 | KEGG DRUG |
| Citations |
|---|