EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:82715 - PH 797804
| Formula | C22H19BrF2N2O3 |
| Net Charge | 0 |
| Average Mass | 477.305 |
| Monoisotopic Mass | 476.05471 |
| SMILES | CNC(=O)c1ccc(C)c(-n2c(C)cc(OCc3ccc(F)cc3F)c(Br)c2=O)c1 |
| InChI | InChI=1S/C22H19BrF2N2O3/c1-12-4-5-14(21(28)26-3)9-18(12)27-13(2)8-19(20(23)22(27)29)30-11-15-6-7-16(24)10-17(15)25/h4-10H,11H2,1-3H3,(H,26,28) |
| InChIKey | KCAJXIDMCNPGHZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PH 797804 (CHEBI:82715) has role anti-inflammatory agent (CHEBI:67079) |
| PH 797804 (CHEBI:82715) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| PH 797804 (CHEBI:82715) is a aromatic ether (CHEBI:35618) |
| PH 797804 (CHEBI:82715) is a benzamides (CHEBI:22702) |
| PH 797804 (CHEBI:82715) is a organobromine compound (CHEBI:37141) |
| PH 797804 (CHEBI:82715) is a organofluorine compound (CHEBI:37143) |
| PH 797804 (CHEBI:82715) is a pyridone (CHEBI:38183) |
| IUPAC Name |
|---|
| 3-{3-bromo-4-[(2,4-difluorobenzyl)oxy]-6-methyl-2-oxopyridin-1(2H)-yl}-N,4-dimethylbenzamide |
| Synonyms | Source |
|---|---|
| 3-Bromo-4-((2,4-difluorobenzyl)oxy)-1-(5-((methylamino)carbonyl)-2-methylphenyl)-6-methylpyridin-2(1H)-one | ChemIDplus |
| PH-797804 | ChemIDplus |
| PH797804 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18380929 | Reaxys |
| CAS:586379-66-0 | ChemIDplus |
| Citations |
|---|