EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19FN6 |
| Net Charge | 0 |
| Average Mass | 338.390 |
| Monoisotopic Mass | 338.16552 |
| SMILES | Nc1nccc(-c2c(-c3ccc(F)cc3)ncn2C2CCNCC2)n1 |
| InChI | InChI=1S/C18H19FN6/c19-13-3-1-12(2-4-13)16-17(15-7-10-22-18(20)24-15)25(11-23-16)14-5-8-21-9-6-14/h1-4,7,10-11,14,21H,5-6,8-9H2,(H2,20,22,24) |
| InChIKey | VSPFURGQAYMVAN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB220025 (CHEBI:82713) has role angiogenesis inhibitor (CHEBI:48422) |
| SB220025 (CHEBI:82713) has role anti-inflammatory agent (CHEBI:67079) |
| SB220025 (CHEBI:82713) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| SB220025 (CHEBI:82713) is a aminopyrimidine (CHEBI:38338) |
| SB220025 (CHEBI:82713) is a imidazoles (CHEBI:24780) |
| SB220025 (CHEBI:82713) is a organofluorine compound (CHEBI:37143) |
| SB220025 (CHEBI:82713) is a piperidines (CHEBI:26151) |
| IUPAC Name |
|---|
| 4-[4-(4-fluorophenyl)-1-(piperidin-4-yl)-1H-imidazol-5-yl]pyrimidin-2-amine |
| Synonyms | Source |
|---|---|
| SB 220025 | ChEBI |
| SB-220025 | ChEBI |
| Citations |
|---|