EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:82708 - AT7867
| Formula | C20H20ClN3 |
| Net Charge | 0 |
| Average Mass | 337.854 |
| Monoisotopic Mass | 337.13458 |
| SMILES | Clc1ccc(C2(c3ccc(-c4cnnc4)cc3)CCNCC2)cc1 |
| InChI | InChI=1S/C20H20ClN3/c21-19-7-5-18(6-8-19)20(9-11-22-12-10-20)17-3-1-15(2-4-17)16-13-23-24-14-16/h1-8,13-14,22H,9-12H2,(H,23,24) |
| InChIKey | LZMOSYUFVYJEPY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of non-specific serine/threonine protein kinase (EC 2.7.11.1), a kinase enzyme involved in phosphorylation of hydroxy group of serine or threonine. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AT7867 (CHEBI:82708) has role antineoplastic agent (CHEBI:35610) |
| AT7867 (CHEBI:82708) has role EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (CHEBI:50925) |
| AT7867 (CHEBI:82708) is a monochlorobenzenes (CHEBI:83403) |
| AT7867 (CHEBI:82708) is a piperidines (CHEBI:26151) |
| AT7867 (CHEBI:82708) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 4-(4-chlorophenyl)-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine |
| Citations |
|---|