EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N4O4Se |
| Net Charge | 0 |
| Average Mass | 363.276 |
| Monoisotopic Mass | 364.06498 |
| SMILES | C[N+](C)(C)[C@@H](Cc1cnc([Se]C[C@H]([NH3+])C(=O)[O-])n1)C(=O)[O-] |
| InChI | InChI=1S/C12H20N4O4Se/c1-16(2,3)9(11(19)20)4-7-5-14-12(15-7)21-6-8(13)10(17)18/h5,8-9H,4,6,13H2,1-3H3,(H2-,14,15,17,18,19,20)/t8-,9-/m0/s1 |
| InChIKey | WUKYFFAYSLDGLI-IUCAKERBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hercynylselenocysteine zwitterion (CHEBI:82705) is a L-α-amino acid zwitterion (CHEBI:59869) |
| hercynylselenocysteine zwitterion (CHEBI:82705) is tautomer of hercynylselenocysteine (CHEBI:79070) |
| Incoming Relation(s) |
| hercynylselenocysteine (CHEBI:79070) is tautomer of hercynylselenocysteine zwitterion (CHEBI:82705) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-({4-[(2S)-2-carboxylato-2-(trimethylazaniumyl)ethyl]-1H-imidazol-2-yl}selanyl)propanoate |
| UniProt Name | Source |
|---|---|
| hercynylselenocysteine | UniProt |