EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18FN7O |
| Net Charge | 0 |
| Average Mass | 415.432 |
| Monoisotopic Mass | 415.15569 |
| SMILES | CC[C@H](Nc1ncnc2ncnc12)c1nc2cccc(F)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C22H18FN7O/c1-2-15(28-20-18-19(25-11-24-18)26-12-27-20)21-29-16-10-6-9-14(23)17(16)22(31)30(21)13-7-4-3-5-8-13/h3-12,15H,2H2,1H3,(H2,24,25,26,27,28)/t15-/m0/s1 |
| InChIKey | IFSDAJWBUCMOAH-HNNXBMFYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor An inhibitor of phosphatidylinositol 3-kinase, EC 2.7.1.137, a family of related enzymes capable of phosphorylating the 3 position hydroxy group of the inositol ring of a phosphatidylinositol. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| idelalisib (CHEBI:82701) has role antineoplastic agent (CHEBI:35610) |
| idelalisib (CHEBI:82701) has role apoptosis inducer (CHEBI:68495) |
| idelalisib (CHEBI:82701) has role EC 2.7.1.137 (phosphatidylinositol 3-kinase) inhibitor (CHEBI:50914) |
| idelalisib (CHEBI:82701) is a aromatic amine (CHEBI:33860) |
| idelalisib (CHEBI:82701) is a organofluorine compound (CHEBI:37143) |
| idelalisib (CHEBI:82701) is a purines (CHEBI:26401) |
| idelalisib (CHEBI:82701) is a quinazolines (CHEBI:38530) |
| idelalisib (CHEBI:82701) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 5-fluoro-3-phenyl-2-[(1S)-1-(3H-purin-6-ylamino)propyl]quinazolin-4(3H)-one |
| Synonyms | Source |
|---|---|
| GS-1101 | ChemIDplus |
| CAL-101 | ChemIDplus |
| 5-Fluoro-3-phenyl-2-((S)-1-(9H-purin-6-ylamino)-propyl)-3H-quinazolin-4-one | ChemIDplus |
| Brand Name | Source |
|---|---|
| ZYDELIG | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Idelalisib | Wikipedia |
| LSM-1205 | LINCS |
| 4878 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12464214 | Reaxys |
| CAS:870281-82-6 | ChemIDplus |
| Citations |
|---|