EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:82698 - suvorexant
| Formula | C23H23ClN6O2 |
| Net Charge | 0 |
| Average Mass | 450.930 |
| Monoisotopic Mass | 450.15710 |
| SMILES | Cc1ccc(-n2nccn2)c(C(=O)N2CCN(c3nc4cc(Cl)ccc4o3)CC[C@H]2C)c1 |
| InChI | InChI=1S/C23H23ClN6O2/c1-15-3-5-20(30-25-8-9-26-30)18(13-15)22(31)29-12-11-28(10-7-16(29)2)23-27-19-14-17(24)4-6-21(19)32-23/h3-6,8-9,13-14,16H,7,10-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | JYTNQNCOQXFQPK-MRXNPFEDSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | orexin receptor antagonist An antagonist that binds to and deactivates orexin receptors. |
| Application: | central nervous system depressant A loosely defined group of drugs that tend to reduce the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| suvorexant (CHEBI:82698) has role central nervous system depressant (CHEBI:35488) |
| suvorexant (CHEBI:82698) has role orexin receptor antagonist (CHEBI:83296) |
| suvorexant (CHEBI:82698) is a 1,3-benzoxazoles (CHEBI:51548) |
| suvorexant (CHEBI:82698) is a aromatic amide (CHEBI:62733) |
| suvorexant (CHEBI:82698) is a diazepine (CHEBI:47918) |
| suvorexant (CHEBI:82698) is a organochlorine compound (CHEBI:36683) |
| suvorexant (CHEBI:82698) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| [(7R)-4-(5-chloro-1,3-benzoxazol-2-yl)-7-methyl-1,4-diazepan-1-yl][5-methyl-2-(2H-1,2,3-triazol-2-yl)phenyl]methanone |
| Synonyms | Source |
|---|---|
| MK-4305 | KEGG DRUG |
| MK 4305 | ChemIDplus |
| MK4305 | ChemIDplus |
| Brand Name | Source |
|---|---|
| BELSOMRA | ChEBI |
| UniProt Name | Source |
|---|---|
| suvorexant | UniProt |
| Manual Xrefs | Databases |
|---|---|
| D10082 | KEGG DRUG |
| Suvorexant | Wikipedia |
| 4881 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18339082 | Reaxys |
| CAS:1030377-33-3 | KEGG DRUG |
| CAS:1030377-33-3 | ChemIDplus |
| Citations |
|---|